C13H26N2 — CID 91082347
1-N'-(5-methyl-4-prop-2-enylhept-6-enyl)ethane-1,1-diamine (PubChem CID 91082347) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-N'-(5-methyl-4-prop-2-enylhept-6-enyl)ethane-1,1-diamine.
| Compound Name | 1-N'-(5-methyl-4-prop-2-enylhept-6-enyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 91082347 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-N'-(5-methyl-4-prop-2-enylhept-6-enyl)ethane-1,1-diamine |
| SMILES | C=CCC(CCCNC(C)N)C(C)C=C |
| InChI | InChI=1S/C13H26N2/c1-5-8-13(11(3)6-2)9-7-10-15-12(4)14/h5-6,11-13,15H,1-2,7-10,14H2,3-4H3 |
| InChIKey | SUOMOPKKNIBHGE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|