C13H27FN2 — CID 166992031
2-(2-ethylbut-3-enyl)-N-(3-fluoropropyl)-N'-methylpropane-1,3-diamine (PubChem CID 166992031) has the molecular formula C13H27FN2 and a molecular weight of 230.37 g/mol. Its IUPAC name is 2-(2-ethylbut-3-enyl)-N-(3-fluoropropyl)-N'-methylpropane-1,3-diamine.
| Compound Name | 2-(2-ethylbut-3-enyl)-N-(3-fluoropropyl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 166992031 |
| Molecular Formula | C13H27FN2 |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 2-(2-ethylbut-3-enyl)-N-(3-fluoropropyl)-N'-methylpropane-1,3-diamine |
| SMILES | C=CC(CC)CC(CNC)CNCCCF |
| InChI | InChI=1S/C13H27FN2/c1-4-12(5-2)9-13(10-15-3)11-16-8-6-7-14/h4,12-13,15-16H,1,5-11H2,2-3H3 |
| InChIKey | JXTKRSQQKCMWTO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|