C14H29FN2 — CID 137469562
N'-(4-ethyl-5-fluoro-2-methylidenehexyl)pentane-1,5-diamine (PubChem CID 137469562) has the molecular formula C14H29FN2 and a molecular weight of 244.40 g/mol. Its IUPAC name is N'-(4-ethyl-5-fluoro-2-methylidenehexyl)pentane-1,5-diamine.
| Compound Name | N'-(4-ethyl-5-fluoro-2-methylidenehexyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 137469562 |
| Molecular Formula | C14H29FN2 |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | N'-(4-ethyl-5-fluoro-2-methylidenehexyl)pentane-1,5-diamine |
| SMILES | C=C(CNCCCCCN)CC(CC)C(C)F |
| InChI | InChI=1S/C14H29FN2/c1-4-14(13(3)15)10-12(2)11-17-9-7-5-6-8-16/h13-14,17H,2,4-11,16H2,1,3H3 |
| InChIKey | INUYXVDXKSRGEH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|