About 1-azidododeca-2,4-diene
1-azidododeca-2,4-diene (PubChem CID 123761820) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-azidododeca-2,4-diene.
Molecular Properties
| Compound Name | 1-azidododeca-2,4-diene |
| PubChem CID | 123761820 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 1-azidododeca-2,4-diene |
| SMILES | CCCCCCCC=CC=CCN=[N+]=[N-] |
| InChI | InChI=1S/C12H21N3/c1-2-3-4-5-6-7-8-9-10-11-12-14-15-13/h8-11H,2-7,12H2,1H3 |
| InChIKey | HAUFVUYYWCEXBF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-azidododeca-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidododeca-2,4-diene?
The IUPAC name of 1-azidododeca-2,4-diene (CID 123761820) is 1-azidododeca-2,4-diene.
What is the SMILES notation for 1-azidododeca-2,4-diene?
The canonical SMILES for 1-azidododeca-2,4-diene is CCCCCCCC=CC=CCN=[N+]=[N-].
What is the InChIKey of 1-azidododeca-2,4-diene?
The InChIKey is HAUFVUYYWCEXBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-2-3-4-5-6-7-8-9-10-11-12-14-15-13/h8-11H,2-7,12H2,1H3.
What are the key properties of 1-azidododeca-2,4-diene?
1-azidododeca-2,4-diene has a molecular weight of 207.32 g/mol, XLogP of 4.77, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidododeca-2,4-diene is sourced from PubChem (CID 123761820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).