About 1-azidohexadec-7-ene
1-azidohexadec-7-ene (PubChem CID 54568004) has the molecular formula C16H31N3
and a molecular weight of 265.44 g/mol. Its IUPAC name is 1-azidohexadec-7-ene.
Molecular Properties
| Compound Name | 1-azidohexadec-7-ene |
| PubChem CID | 54568004 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 1-azidohexadec-7-ene |
| SMILES | CCCCCCCCC=CCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C16H31N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-19-17/h9-10H,2-8,11-16H2,1H3 |
| InChIKey | ZVEYWUATGFKVNP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-azidohexadec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidohexadec-7-ene?
The IUPAC name of 1-azidohexadec-7-ene (CID 54568004) is 1-azidohexadec-7-ene.
What is the SMILES notation for 1-azidohexadec-7-ene?
The canonical SMILES for 1-azidohexadec-7-ene is CCCCCCCCC=CCCCCCCN=[N+]=[N-].
What is the InChIKey of 1-azidohexadec-7-ene?
The InChIKey is ZVEYWUATGFKVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-19-17/h9-10H,2-8,11-16H2,1H3.
What are the key properties of 1-azidohexadec-7-ene?
1-azidohexadec-7-ene has a molecular weight of 265.44 g/mol, XLogP of 6.55, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidohexadec-7-ene is sourced from PubChem (CID 54568004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).