About (Z)-1-azidooctadec-9-ene
(Z)-1-azidooctadec-9-ene (PubChem CID 51355200) has the molecular formula C18H35N3
and a molecular weight of 293.50 g/mol. Its IUPAC name is (Z)-1-azidooctadec-9-ene.
Molecular Properties
| Compound Name | (Z)-1-azidooctadec-9-ene |
| PubChem CID | 51355200 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | (Z)-1-azidooctadec-9-ene |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C18H35N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-21-19/h9-10H,2-8,11-18H2,1H3/b10-9- |
| InChIKey | GXVZKGGXCHNXOZ-KTKRTIGZSA-N |
| XLogP | 7.33 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-azidooctadec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-azidooctadec-9-ene?
The IUPAC name of (Z)-1-azidooctadec-9-ene (CID 51355200) is (Z)-1-azidooctadec-9-ene.
What is the SMILES notation for (Z)-1-azidooctadec-9-ene?
The canonical SMILES for (Z)-1-azidooctadec-9-ene is CCCCCCCC/C=C\CCCCCCCCN=[N+]=[N-].
What is the InChIKey of (Z)-1-azidooctadec-9-ene?
The InChIKey is GXVZKGGXCHNXOZ-KTKRTIGZSA-N. The full InChI is InChI=1S/C18H35N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-21-19/h9-10H,2-8,11-18H2,1H3/b10-9-.
What are the key properties of (Z)-1-azidooctadec-9-ene?
(Z)-1-azidooctadec-9-ene has a molecular weight of 293.50 g/mol, XLogP of 7.33, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-azidooctadec-9-ene is sourced from PubChem (CID 51355200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).