C27H45N3 — CID 10476747
(6E,10E,14E,18E)-22-azido-2,6,10,15,19-pentamethyldocosa-2,6,10,14,18-pentaene (PubChem CID 10476747) has the molecular formula C27H45N3 and a molecular weight of 411.68 g/mol. Its IUPAC name is (6E,10E,14E,18E)-22-azido-2,6,10,15,19-pentamethyldocosa-2,6,10,14,18-pentaene.
| Compound Name | (6E,10E,14E,18E)-22-azido-2,6,10,15,19-pentamethyldocosa-2,6,10,14,18-pentaene |
|---|---|
| PubChem CID | 10476747 |
| Molecular Formula | C27H45N3 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.36 |
| IUPAC Name | (6E,10E,14E,18E)-22-azido-2,6,10,15,19-pentamethyldocosa-2,6,10,14,18-pentaene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCCN=[N+]=[N-] |
| InChI | InChI=1S/C27H45N3/c1-23(2)13-9-16-26(5)19-10-17-24(3)14-7-8-15-25(4)18-11-20-27(6)21-12-22-29-30-28/h13-15,19-20H,7-12,16-18,21-22H2,1-6H3/b24-14+,25-15+,26-19+,27-20+ |
| InChIKey | YPZDRIZIFOIVDJ-OGDZRKEVSA-N |
| XLogP | 9.95 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|