C15H26N2 — CID 90783684
3,7,11-trimethyldodeca-3,6,10-trienyldiazene (PubChem CID 90783684) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-3,6,10-trienyldiazene.
| Compound Name | 3,7,11-trimethyldodeca-3,6,10-trienyldiazene |
|---|---|
| PubChem CID | 90783684 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 3,7,11-trimethyldodeca-3,6,10-trienyldiazene |
| SMILES | [H]/N=N/CCC(C)=CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C15H26N2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-17-16/h7,9-10,16H,5-6,8,11-12H2,1-4H3/b14-9?,15-10?,17-16+ |
| InChIKey | KEHULHFXAYJKGO-HAJKWASFSA-N |
| XLogP | 5.44 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|