C10H17N3 — CID 54335697
1-azido-3,7-dimethylocta-2,6-diene (PubChem CID 54335697) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-azido-3,7-dimethylocta-2,6-diene.
| Compound Name | 1-azido-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 54335697 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-azido-3,7-dimethylocta-2,6-diene |
| SMILES | CC(C)=CCCC(C)=CCN=[N+]=[N-] |
| InChI | InChI=1S/C10H17N3/c1-9(2)5-4-6-10(3)7-8-12-13-11/h5,7H,4,6,8H2,1-3H3 |
| InChIKey | TVHVHSOCOVZUCZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|