C15H25N3 — CID 10014874
(2E,6E)-1-azido-3,7,11-trimethyldodeca-2,6,10-triene (PubChem CID 10014874) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (2E,6E)-1-azido-3,7,11-trimethyldodeca-2,6,10-triene.
| Compound Name | (2E,6E)-1-azido-3,7,11-trimethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 10014874 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (2E,6E)-1-azido-3,7,11-trimethyldodeca-2,6,10-triene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN=[N+]=[N-] |
| InChI | InChI=1S/C15H25N3/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-17-18-16/h7,9,11H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| InChIKey | NABGUVGEYUSZJC-YFVJMOTDSA-N |
| XLogP | 5.72 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|