C28H52N2 — CID 20559016
(5Z,9Z)-3,12-di(nonyl)-1,2-diazacyclododeca-1,5,9-triene (PubChem CID 20559016) has the molecular formula C28H52N2 and a molecular weight of 416.74 g/mol. Its IUPAC name is (5Z,9Z)-3,12-di(nonyl)-1,2-diazacyclododeca-1,5,9-triene.
| Compound Name | (5Z,9Z)-3,12-di(nonyl)-1,2-diazacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 20559016 |
| Molecular Formula | C28H52N2 |
| Molecular Weight | 416.74 g/mol |
| Exact Mass | 416.41 |
| IUPAC Name | (5Z,9Z)-3,12-di(nonyl)-1,2-diazacyclododeca-1,5,9-triene |
| SMILES | CCCCCCCCCC1C/C=C\CC/C=C\CC(CCCCCCCCC)/N=N/1 |
| InChI | InChI=1S/C28H52N2/c1-3-5-7-9-11-15-19-23-27-25-21-17-13-14-18-22-26-28(30-29-27)24-20-16-12-10-8-6-4-2/h17-18,21-22,27-28H,3-16,19-20,23-26H2,1-2H3/b21-17-,22-18-,30-29+ |
| InChIKey | BBTRCYYUMSSYHU-YHWUGEMKSA-N |
| XLogP | 10.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.74 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|