About 11-azidotricos-1-ene
11-azidotricos-1-ene (PubChem CID 19032292) has the molecular formula C23H45N3
and a molecular weight of 363.63 g/mol. Its IUPAC name is 11-azidotricos-1-ene.
Molecular Properties
| Compound Name | 11-azidotricos-1-ene |
| PubChem CID | 19032292 |
| Molecular Formula | C23H45N3 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.36 |
| IUPAC Name | 11-azidotricos-1-ene |
| SMILES | C=CCCCCCCCCC(CCCCCCCCCCCC)N=[N+]=[N-] |
| InChI | InChI=1S/C23H45N3/c1-3-5-7-9-11-13-14-16-18-20-22-23(25-26-24)21-19-17-15-12-10-8-6-4-2/h4,23H,2-3,5-22H2,1H3 |
| InChIKey | LZJCPNQMQZAFLT-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-azidotricos-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-azidotricos-1-ene?
The IUPAC name of 11-azidotricos-1-ene (CID 19032292) is 11-azidotricos-1-ene.
What is the SMILES notation for 11-azidotricos-1-ene?
The canonical SMILES for 11-azidotricos-1-ene is C=CCCCCCCCCC(CCCCCCCCCCCC)N=[N+]=[N-].
What is the InChIKey of 11-azidotricos-1-ene?
The InChIKey is LZJCPNQMQZAFLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H45N3/c1-3-5-7-9-11-13-14-16-18-20-22-23(25-26-24)21-19-17-15-12-10-8-6-4-2/h4,23H,2-3,5-22H2,1H3.
What are the key properties of 11-azidotricos-1-ene?
11-azidotricos-1-ene has a molecular weight of 363.63 g/mol, XLogP of 9.28, 21 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-azidotricos-1-ene is sourced from PubChem (CID 19032292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).