C26H48N2 — CID 20559044
(5Z,9Z)-3,12-dioctyl-1,2-diazacyclododeca-1,5,9-triene (PubChem CID 20559044) has the molecular formula C26H48N2 and a molecular weight of 388.68 g/mol. Its IUPAC name is (5Z,9Z)-3,12-dioctyl-1,2-diazacyclododeca-1,5,9-triene.
| Compound Name | (5Z,9Z)-3,12-dioctyl-1,2-diazacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 20559044 |
| Molecular Formula | C26H48N2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.38 |
| IUPAC Name | (5Z,9Z)-3,12-dioctyl-1,2-diazacyclododeca-1,5,9-triene |
| SMILES | CCCCCCCCC1C/C=C\CC/C=C\CC(CCCCCCCC)/N=N/1 |
| InChI | InChI=1S/C26H48N2/c1-3-5-7-9-13-17-21-25-23-19-15-11-12-16-20-24-26(28-27-25)22-18-14-10-8-6-4-2/h15-16,19-20,25-26H,3-14,17-18,21-24H2,1-2H3/b19-15-,20-16-,28-27+ |
| InChIKey | QCQFYCNHNJRIRE-RVTGTLGLSA-N |
| XLogP | 9.36 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|