C21H24N6O — CID 123762470
1-[8-[6-(2,6-dimethylmorpholin-4-yl)pyrimidin-4-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-yl]-N-methylpropane-1,3-diimine (PubChem CID 123762470) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[8-[6-(2,6-dimethylmorpholin-4-yl)pyrimidin-4-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-yl]-N-methylpropane-1,3-diimine.
| Compound Name | 1-[8-[6-(2,6-dimethylmorpholin-4-yl)pyrimidin-4-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-yl]-N-methylpropane-1,3-diimine |
|---|---|
| PubChem CID | 123762470 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-[8-[6-(2,6-dimethylmorpholin-4-yl)pyrimidin-4-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-yl]-N-methylpropane-1,3-diimine |
| SMILES | [H]/N=C/C/C(=N\C)c1ccc2c(c1)C(c1cc(N3CC(C)OC(C)C3)ncn1)=N2 |
| InChI | InChI=1S/C21H24N6O/c1-13-10-27(11-14(2)28-13)20-9-19(24-12-25-20)21-16-8-15(4-5-18(16)26-21)17(23-3)6-7-22/h4-5,7-9,12-14,22H,6,10-11H2,1-3H3/b22-7+,23-17+ |
| InChIKey | OQSVQTIWUHYGBX-KEZNIOLFSA-N |
| XLogP | 3.03 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|