C28H29ClF3N5O4 — CID 123762806
2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-2-[3-fluoro-N-[2-[(2-methoxyacetyl)-pyrimidin-2-ylamino]ethoxymethyl]anilino]acetamide (PubChem CID 123762806) has the molecular formula C28H29ClF3N5O4 and a molecular weight of 592.02 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-2-[3-fluoro-N-[2-[(2-methoxyacetyl)-pyrimidin-2-ylamino]ethoxymethyl]anilino]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-2-[3-fluoro-N-[2-[(2-methoxyacetyl)-pyrimidin-2-ylamino]ethoxymethyl]anilino]acetamide |
|---|---|
| PubChem CID | 123762806 |
| Molecular Formula | C28H29ClF3N5O4 |
| Molecular Weight | 592.02 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-2-[3-fluoro-N-[2-[(2-methoxyacetyl)-pyrimidin-2-ylamino]ethoxymethyl]anilino]acetamide |
| SMILES | COCC(=O)N(CCOCN(c1cccc(F)c1)C(C(=O)NC1CC(F)(F)C1)c1ccccc1Cl)c1ncccn1 |
| InChI | InChI=1S/C28H29ClF3N5O4/c1-40-17-24(38)36(27-33-10-5-11-34-27)12-13-41-18-37(21-7-4-6-19(30)14-21)25(22-8-2-3-9-23(22)29)26(39)35-20-15-28(31,32)16-20/h2-11,14,20,25H,12-13,15-18H2,1H3,(H,35,39) |
| InChIKey | UUVICYIBVHITRG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.02 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|