C26H26ClF2N5 — CID 123762873
N-[[3-(2-chloro-4-pyridinyl)-6-methyl-1H-indazol-5-yl]methyl]-1-[(2,6-difluorophenyl)methyl]piperidin-3-amine (PubChem CID 123762873) has the molecular formula C26H26ClF2N5 and a molecular weight of 481.98 g/mol. Its IUPAC name is N-[[3-(2-chloro-4-pyridinyl)-6-methyl-1H-indazol-5-yl]methyl]-1-[(2,6-difluorophenyl)methyl]piperidin-3-amine.
| Compound Name | N-[[3-(2-chloro-4-pyridinyl)-6-methyl-1H-indazol-5-yl]methyl]-1-[(2,6-difluorophenyl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 123762873 |
| Molecular Formula | C26H26ClF2N5 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-[[3-(2-chloro-4-pyridinyl)-6-methyl-1H-indazol-5-yl]methyl]-1-[(2,6-difluorophenyl)methyl]piperidin-3-amine |
| SMILES | Cc1cc2[nH]nc(-c3ccnc(Cl)c3)c2cc1CNC1CCCN(Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C26H26ClF2N5/c1-16-10-24-20(26(33-32-24)17-7-8-30-25(27)12-17)11-18(16)13-31-19-4-3-9-34(14-19)15-21-22(28)5-2-6-23(21)29/h2,5-8,10-12,19,31H,3-4,9,13-15H2,1H3,(H,32,33) |
| InChIKey | WPNQKRKDTNRDGU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|