C28H34FN5O2 — CID 56941200
N-[1-[(2,6-dimethylphenyl)methyl]piperidin-3-yl]-3-(3-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 56941200) has the molecular formula C28H34FN5O2 and a molecular weight of 491.61 g/mol. Its IUPAC name is N-[1-[(2,6-dimethylphenyl)methyl]piperidin-3-yl]-3-(3-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | N-[1-[(2,6-dimethylphenyl)methyl]piperidin-3-yl]-3-(3-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 56941200 |
| Molecular Formula | C28H34FN5O2 |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | N-[1-[(2,6-dimethylphenyl)methyl]piperidin-3-yl]-3-(3-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | COc1ccc(-c2n[nH]c3c2CN(C(=O)NC2CCCN(Cc4c(C)cccc4C)C2)CC3)cc1F |
| InChI | InChI=1S/C28H34FN5O2/c1-18-6-4-7-19(2)22(18)16-33-12-5-8-21(15-33)30-28(35)34-13-11-25-23(17-34)27(32-31-25)20-9-10-26(36-3)24(29)14-20/h4,6-7,9-10,14,21H,5,8,11-13,15-17H2,1-3H3,(H,30,35)(H,31,32) |
| InChIKey | LLHSDEXQOVUTLF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |