C29H33FN4O3 — CID 147922635
1-[3-(2,3-dihydro-1-benzofuran-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-[(3S)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]ethanone (PubChem CID 147922635) has the molecular formula C29H33FN4O3 and a molecular weight of 504.61 g/mol. Its IUPAC name is 1-[3-(2,3-dihydro-1-benzofuran-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-[(3S)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]ethanone.
| Compound Name | 1-[3-(2,3-dihydro-1-benzofuran-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-[(3S)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]ethanone |
|---|---|
| PubChem CID | 147922635 |
| Molecular Formula | C29H33FN4O3 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 1-[3-(2,3-dihydro-1-benzofuran-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-[(3S)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]ethanone |
| SMILES | COc1cccc(F)c1CN1CCC[C@@H](CC(=O)N2CCc3[nH]nc(-c4ccc5c(c4)CCO5)c3C2)C1 |
| InChI | InChI=1S/C29H33FN4O3/c1-36-27-6-2-5-24(30)22(27)17-33-11-3-4-19(16-33)14-28(35)34-12-9-25-23(18-34)29(32-31-25)21-7-8-26-20(15-21)10-13-37-26/h2,5-8,15,19H,3-4,9-14,16-18H2,1H3,(H,31,32)/t19-/m0/s1 |
| InChIKey | IIICGZSJUVAKHX-IBGZPJMESA-N |
| XLogP | 4.35 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |