C16H26FNO — CID 144598997
ethane;(3R)-1-[(2-fluoro-6-methoxyphenyl)methyl]-3-methylpiperidine (PubChem CID 144598997) has the molecular formula C16H26FNO and a molecular weight of 267.39 g/mol. Its IUPAC name is ethane;(3R)-1-[(2-fluoro-6-methoxyphenyl)methyl]-3-methylpiperidine.
| Compound Name | ethane;(3R)-1-[(2-fluoro-6-methoxyphenyl)methyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 144598997 |
| Molecular Formula | C16H26FNO |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | ethane;(3R)-1-[(2-fluoro-6-methoxyphenyl)methyl]-3-methylpiperidine |
| SMILES | CC.COc1cccc(F)c1CN1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C14H20FNO.C2H6/c1-11-5-4-8-16(9-11)10-12-13(15)6-3-7-14(12)17-2;1-2/h3,6-7,11H,4-5,8-10H2,1-2H3;1-2H3/t11-;/m1./s1 |
| InChIKey | SKJQZBVKGXAQRP-RFVHGSKJSA-N |
| XLogP | 4.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |