C18H25NO3 — CID 27241348
(3R)-1-[4-(2,6-dimethoxyphenoxy)but-2-ynyl]-3-methylpiperidine (PubChem CID 27241348) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (3R)-1-[4-(2,6-dimethoxyphenoxy)but-2-ynyl]-3-methylpiperidine.
| Compound Name | (3R)-1-[4-(2,6-dimethoxyphenoxy)but-2-ynyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 27241348 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (3R)-1-[4-(2,6-dimethoxyphenoxy)but-2-ynyl]-3-methylpiperidine |
| SMILES | COc1cccc(OC)c1OCC#CCN1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C18H25NO3/c1-15-8-7-12-19(14-15)11-4-5-13-22-18-16(20-2)9-6-10-17(18)21-3/h6,9-10,15H,7-8,11-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | QXRLDLPSHVAYTH-OAHLLOKOSA-N |
| XLogP | 2.82 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|