C28H30F3N3O2 — CID 159529057
2-[(3S)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]-1-[3-(3-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl]ethanone (PubChem CID 159529057) has the molecular formula C28H30F3N3O2 and a molecular weight of 497.56 g/mol. Its IUPAC name is 2-[(3S)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]-1-[3-(3-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl]ethanone.
| Compound Name | 2-[(3S)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]-1-[3-(3-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 159529057 |
| Molecular Formula | C28H30F3N3O2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-[(3S)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]-1-[3-(3-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl]ethanone |
| SMILES | COc1ccc(C2=NCC3=C2CN(C(=O)C[C@@H]2CCCN(Cc4c(F)cccc4F)C2)CC3)cc1F |
| InChI | InChI=1S/C28H30F3N3O2/c1-36-26-8-7-19(13-25(26)31)28-21-17-34(11-9-20(21)14-32-28)27(35)12-18-4-3-10-33(15-18)16-22-23(29)5-2-6-24(22)30/h2,5-8,13,18H,3-4,9-12,14-17H2,1H3/t18-/m0/s1 |
| InChIKey | NCFBLDITFZFOCR-SFHVURJKSA-N |
| XLogP | 4.75 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |