C28H28F3N5O — CID 160682065
2-[1-[(2,6-difluorophenyl)methyl]-4-fluoropiperidin-3-yl]-1-(3-imidazo[1,2-a]pyridin-6-yl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl)ethanone (PubChem CID 160682065) has the molecular formula C28H28F3N5O and a molecular weight of 507.56 g/mol. Its IUPAC name is 2-[1-[(2,6-difluorophenyl)methyl]-4-fluoropiperidin-3-yl]-1-(3-imidazo[1,2-a]pyridin-6-yl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl)ethanone.
| Compound Name | 2-[1-[(2,6-difluorophenyl)methyl]-4-fluoropiperidin-3-yl]-1-(3-imidazo[1,2-a]pyridin-6-yl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 160682065 |
| Molecular Formula | C28H28F3N5O |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2-[1-[(2,6-difluorophenyl)methyl]-4-fluoropiperidin-3-yl]-1-(3-imidazo[1,2-a]pyridin-6-yl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl)ethanone |
| SMILES | O=C(CC1CN(Cc2c(F)cccc2F)CCC1F)N1CCC2=C(C1)C(c1ccc3nccn3c1)=NC2 |
| InChI | InChI=1S/C28H28F3N5O/c29-23-7-9-34(16-22-24(30)2-1-3-25(22)31)14-20(23)12-27(37)36-10-6-18-13-33-28(21(18)17-36)19-4-5-26-32-8-11-35(26)15-19/h1-5,8,11,15,20,23H,6-7,9-10,12-14,16-17H2 |
| InChIKey | UJJVQVQVKCNGEO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |