C30H29F2N3O3 — CID 160976861
[2-amino-5-[6-[2-[(3S)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]acetyl]-3H-isoindol-1-yl]phenyl] acetate (PubChem CID 160976861) has the molecular formula C30H29F2N3O3 and a molecular weight of 517.58 g/mol. Its IUPAC name is [2-amino-5-[6-[2-[(3S)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]acetyl]-3H-isoindol-1-yl]phenyl] acetate.
| Compound Name | [2-amino-5-[6-[2-[(3S)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]acetyl]-3H-isoindol-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 160976861 |
| Molecular Formula | C30H29F2N3O3 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | [2-amino-5-[6-[2-[(3S)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]acetyl]-3H-isoindol-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(C2=NCc3ccc(C(=O)C[C@@H]4CCCN(Cc5c(F)cccc5F)C4)cc32)ccc1N |
| InChI | InChI=1S/C30H29F2N3O3/c1-18(36)38-29-14-21(9-10-27(29)33)30-23-13-20(7-8-22(23)15-34-30)28(37)12-19-4-3-11-35(16-19)17-24-25(31)5-2-6-26(24)32/h2,5-10,13-14,19H,3-4,11-12,15-17,33H2,1H3/t19-/m0/s1 |
| InChIKey | XYZGBOKRUOOQDT-IBGZPJMESA-N |
| XLogP | 5.31 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|