C29H30N6OS2 — CID 56941780
N-[1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 56941780) has the molecular formula C29H30N6OS2 and a molecular weight of 542.73 g/mol. Its IUPAC name is N-[1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | N-[1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 56941780 |
| Molecular Formula | C29H30N6OS2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | N-[1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | Cc1nc2ccc(-c3n[nH]c4c3CN(C(=O)NC3CCCN(Cc5csc6ccccc56)C3)CC4)cc2s1 |
| InChI | InChI=1S/C29H30N6OS2/c1-18-30-25-9-8-19(13-27(25)38-18)28-23-16-35(12-10-24(23)32-33-28)29(36)31-21-5-4-11-34(15-21)14-20-17-37-26-7-3-2-6-22(20)26/h2-3,6-9,13,17,21H,4-5,10-12,14-16H2,1H3,(H,31,36)(H,32,33) |
| InChIKey | LZJGFZQTOZLOCO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |