C41H48O16 — CID 123763684
1-O-methyl 5-O-[2-[2-(2-oxochromen-6-yl)oxyacetyl]oxyethyl] 2-ethyl-2,4-dimethylpentanedioate;2-[2-(2-oxochromen-6-yl)oxyacetyl]oxyethyl 2-methylbutanoate (PubChem CID 123763684) has the molecular formula C41H48O16 and a molecular weight of 796.82 g/mol. Its IUPAC name is 1-O-methyl 5-O-[2-[2-(2-oxochromen-6-yl)oxyacetyl]oxyethyl] 2-ethyl-2,4-dimethylpentanedioate;2-[2-(2-oxochromen-6-yl)oxyacetyl]oxyethyl 2-methylbutanoate.
| Compound Name | 1-O-methyl 5-O-[2-[2-(2-oxochromen-6-yl)oxyacetyl]oxyethyl] 2-ethyl-2,4-dimethylpentanedioate;2-[2-(2-oxochromen-6-yl)oxyacetyl]oxyethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 123763684 |
| Molecular Formula | C41H48O16 |
| Molecular Weight | 796.82 g/mol |
| Exact Mass | 796.29 |
| IUPAC Name | 1-O-methyl 5-O-[2-[2-(2-oxochromen-6-yl)oxyacetyl]oxyethyl] 2-ethyl-2,4-dimethylpentanedioate;2-[2-(2-oxochromen-6-yl)oxyacetyl]oxyethyl 2-methylbutanoate |
| SMILES | CCC(C)(CC(C)C(=O)OCCOC(=O)COc1ccc2oc(=O)ccc2c1)C(=O)OC.CCC(C)C(=O)OCCOC(=O)COc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C23H28O9.C18H20O7/c1-5-23(3,22(27)28-4)13-15(2)21(26)30-11-10-29-20(25)14-31-17-7-8-18-16(12-17)6-9-19(24)32-18;1-3-12(2)18(21)23-9-8-22-17(20)11-24-14-5-6-15-13(10-14)4-7-16(19)25-15/h6-9,12,15H,5,10-11,13-14H2,1-4H3;4-7,10,12H,3,8-9,11H2,1-2H3 |
| InChIKey | GWFPWFGQIXILFG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 210.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.82 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|