C27H30O7 — CID 58420956
methyl 2-ethyl-2-methyl-4-[4-[2-(3-methyl-2-oxochromen-6-yl)oxyacetyl]oxyphenyl]pentanoate (PubChem CID 58420956) has the molecular formula C27H30O7 and a molecular weight of 466.53 g/mol. Its IUPAC name is methyl 2-ethyl-2-methyl-4-[4-[2-(3-methyl-2-oxochromen-6-yl)oxyacetyl]oxyphenyl]pentanoate.
| Compound Name | methyl 2-ethyl-2-methyl-4-[4-[2-(3-methyl-2-oxochromen-6-yl)oxyacetyl]oxyphenyl]pentanoate |
|---|---|
| PubChem CID | 58420956 |
| Molecular Formula | C27H30O7 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | methyl 2-ethyl-2-methyl-4-[4-[2-(3-methyl-2-oxochromen-6-yl)oxyacetyl]oxyphenyl]pentanoate |
| SMILES | CCC(C)(CC(C)c1ccc(OC(=O)COc2ccc3oc(=O)c(C)cc3c2)cc1)C(=O)OC |
| InChI | InChI=1S/C27H30O7/c1-6-27(4,26(30)31-5)15-18(3)19-7-9-21(10-8-19)33-24(28)16-32-22-11-12-23-20(14-22)13-17(2)25(29)34-23/h7-14,18H,6,15-16H2,1-5H3 |
| InChIKey | WOKVOOXPIHFYRC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|