C18H23F3O4 — CID 155645480
2-ethyl-2-methyl-4-[4-(3,3,3-trifluoro-2-methylpropanoyl)oxyphenyl]pentanoic acid (PubChem CID 155645480) has the molecular formula C18H23F3O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-ethyl-2-methyl-4-[4-(3,3,3-trifluoro-2-methylpropanoyl)oxyphenyl]pentanoic acid.
| Compound Name | 2-ethyl-2-methyl-4-[4-(3,3,3-trifluoro-2-methylpropanoyl)oxyphenyl]pentanoic acid |
|---|---|
| PubChem CID | 155645480 |
| Molecular Formula | C18H23F3O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-ethyl-2-methyl-4-[4-(3,3,3-trifluoro-2-methylpropanoyl)oxyphenyl]pentanoic acid |
| SMILES | CCC(C)(CC(C)c1ccc(OC(=O)C(C)C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C18H23F3O4/c1-5-17(4,16(23)24)10-11(2)13-6-8-14(9-7-13)25-15(22)12(3)18(19,20)21/h6-9,11-12H,5,10H2,1-4H3,(H,23,24) |
| InChIKey | UIMBNMYWVFQISZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|