C19H34O3 — CID 142270004
ethane;2-methyl-2-[(4-propan-2-ylphenoxy)methyl]butanoic acid (PubChem CID 142270004) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is ethane;2-methyl-2-[(4-propan-2-ylphenoxy)methyl]butanoic acid.
| Compound Name | ethane;2-methyl-2-[(4-propan-2-ylphenoxy)methyl]butanoic acid |
|---|---|
| PubChem CID | 142270004 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | ethane;2-methyl-2-[(4-propan-2-ylphenoxy)methyl]butanoic acid |
| SMILES | CC.CC.CCC(C)(COc1ccc(C(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C15H22O3.2C2H6/c1-5-15(4,14(16)17)10-18-13-8-6-12(7-9-13)11(2)3;2*1-2/h6-9,11H,5,10H2,1-4H3,(H,16,17);2*1-2H3 |
| InChIKey | VUUVWRSWGYJBTQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |