C23H30F6O5 — CID 89115671
[4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethoxy]phenyl] 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate (PubChem CID 89115671) has the molecular formula C23H30F6O5 and a molecular weight of 500.48 g/mol. Its IUPAC name is [4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethoxy]phenyl] 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate.
| Compound Name | [4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethoxy]phenyl] 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate |
|---|---|
| PubChem CID | 89115671 |
| Molecular Formula | C23H30F6O5 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | [4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethoxy]phenyl] 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate |
| SMILES | CCC(C)(C)C(C)(CC(C)C)C(=O)Oc1ccc(OCC(=O)OC(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H30F6O5/c1-7-20(4,5)21(6,12-14(2)3)19(31)33-16-10-8-15(9-11-16)32-13-17(30)34-18(22(24,25)26)23(27,28)29/h8-11,14,18H,7,12-13H2,1-6H3 |
| InChIKey | ZUCFAVJJGXIRBM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|