C16H20F2O5 — CID 129223020
[4-[2-(2,2-difluoroethoxy)-2-oxoethoxy]phenyl] 2,2-dimethylbutanoate (PubChem CID 129223020) has the molecular formula C16H20F2O5 and a molecular weight of 330.33 g/mol. Its IUPAC name is [4-[2-(2,2-difluoroethoxy)-2-oxoethoxy]phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[2-(2,2-difluoroethoxy)-2-oxoethoxy]phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 129223020 |
| Molecular Formula | C16H20F2O5 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [4-[2-(2,2-difluoroethoxy)-2-oxoethoxy]phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(OCC(=O)OCC(F)F)cc1 |
| InChI | InChI=1S/C16H20F2O5/c1-4-16(2,3)15(20)23-12-7-5-11(6-8-12)21-10-14(19)22-9-13(17)18/h5-8,13H,4,9-10H2,1-3H3 |
| InChIKey | XGRLUMRLHZSWFX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|