About (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate
(4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate (PubChem CID 58420963) has the molecular formula C22H21NO5
and a molecular weight of 379.41 g/mol. Its IUPAC name is (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate.
Molecular Properties
| Compound Name | (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate |
| PubChem CID | 58420963 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate |
| SMILES | [H]/N=C/c1cc2cc(OCC(=O)Oc3ccc(C(C)CC)cc3)ccc2oc1=O |
| InChI | InChI=1S/C22H21NO5/c1-3-14(2)15-4-6-18(7-5-15)27-21(24)13-26-19-8-9-20-16(11-19)10-17(12-23)22(25)28-20/h4-12,14,23H,3,13H2,1-2H3/b23-12+ |
| InChIKey | VQJLKPWQAFIQJC-FSJBWODESA-N |
| XLogP | 4.29 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate?
The IUPAC name of (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate (CID 58420963) is (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate.
What is the SMILES notation for (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate?
The canonical SMILES for (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate is [H]/N=C/c1cc2cc(OCC(=O)Oc3ccc(C(C)CC)cc3)ccc2oc1=O.
What is the InChIKey of (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate?
The InChIKey is VQJLKPWQAFIQJC-FSJBWODESA-N. The full InChI is InChI=1S/C22H21NO5/c1-3-14(2)15-4-6-18(7-5-15)27-21(24)13-26-19-8-9-20-16(11-19)10-17(12-23)22(25)28-20/h4-12,14,23H,3,13H2,1-2H3/b23-12+.
What are the key properties of (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate?
(4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate has a molecular weight of 379.41 g/mol, XLogP of 4.29, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butan-2-ylphenyl) 2-(3-methanimidoyl-2-oxochromen-6-yl)oxyacetate is sourced from PubChem (CID 58420963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).