C22H19NO5 — CID 58420972
(4-butan-2-ylphenyl) 2-(3-cyano-2-oxochromen-7-yl)oxyacetate (PubChem CID 58420972) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is (4-butan-2-ylphenyl) 2-(3-cyano-2-oxochromen-7-yl)oxyacetate.
| Compound Name | (4-butan-2-ylphenyl) 2-(3-cyano-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 58420972 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (4-butan-2-ylphenyl) 2-(3-cyano-2-oxochromen-7-yl)oxyacetate |
| SMILES | CCC(C)c1ccc(OC(=O)COc2ccc3cc(C#N)c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C22H19NO5/c1-3-14(2)15-4-7-18(8-5-15)27-21(24)13-26-19-9-6-16-10-17(12-23)22(25)28-20(16)11-19/h4-11,14H,3,13H2,1-2H3 |
| InChIKey | JSAOPHIMQCRNKI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 89.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|