C19H17N9 — CID 123763974
2,6-bis[bis(1H-pyrazol-5-yl)methyl]pyridine (PubChem CID 123763974) has the molecular formula C19H17N9 and a molecular weight of 371.41 g/mol. Its IUPAC name is 2,6-bis[bis(1H-pyrazol-5-yl)methyl]pyridine.
| Compound Name | 2,6-bis[bis(1H-pyrazol-5-yl)methyl]pyridine |
|---|---|
| PubChem CID | 123763974 |
| Molecular Formula | C19H17N9 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2,6-bis[bis(1H-pyrazol-5-yl)methyl]pyridine |
| SMILES | c1cc(C(c2ccn[nH]2)c2ccn[nH]2)nc(C(c2ccn[nH]2)c2ccn[nH]2)c1 |
| InChI | InChI=1S/C19H17N9/c1-2-12(18(14-4-8-20-25-14)15-5-9-21-26-15)24-13(3-1)19(16-6-10-22-27-16)17-7-11-23-28-17/h1-11,18-19H,(H,20,25)(H,21,26)(H,22,27)(H,23,28) |
| InChIKey | HFUPBKWQTYVZHV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |