C25H16F3NO3S — CID 123764091
(3,9-diphenylcarbazol-2-yl) trifluoromethanesulfonate (PubChem CID 123764091) has the molecular formula C25H16F3NO3S and a molecular weight of 467.47 g/mol. Its IUPAC name is (3,9-diphenylcarbazol-2-yl) trifluoromethanesulfonate.
| Compound Name | (3,9-diphenylcarbazol-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 123764091 |
| Molecular Formula | C25H16F3NO3S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | (3,9-diphenylcarbazol-2-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(cc1-c1ccccc1)c1ccccc1n2-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H16F3NO3S/c26-25(27,28)33(30,31)32-24-16-23-21(15-20(24)17-9-3-1-4-10-17)19-13-7-8-14-22(19)29(23)18-11-5-2-6-12-18/h1-16H |
| InChIKey | QWCNIABDKCHKEN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|