About 4-isocyano-1,2-dimethylcyclohexene
4-isocyano-1,2-dimethylcyclohexene (PubChem CID 123764505) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 4-isocyano-1,2-dimethylcyclohexene.
Molecular Properties
| Compound Name | 4-isocyano-1,2-dimethylcyclohexene |
| PubChem CID | 123764505 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 4-isocyano-1,2-dimethylcyclohexene |
| SMILES | [C-]#[N+]C1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C9H13N/c1-7-4-5-9(10-3)6-8(7)2/h9H,4-6H2,1-2H3 |
| InChIKey | QJFROPFTZBAGRO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyano-1,2-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyano-1,2-dimethylcyclohexene?
The IUPAC name of 4-isocyano-1,2-dimethylcyclohexene (CID 123764505) is 4-isocyano-1,2-dimethylcyclohexene.
What is the SMILES notation for 4-isocyano-1,2-dimethylcyclohexene?
The canonical SMILES for 4-isocyano-1,2-dimethylcyclohexene is [C-]#[N+]C1CCC(C)=C(C)C1.
What is the InChIKey of 4-isocyano-1,2-dimethylcyclohexene?
The InChIKey is QJFROPFTZBAGRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-7-4-5-9(10-3)6-8(7)2/h9H,4-6H2,1-2H3.
What are the key properties of 4-isocyano-1,2-dimethylcyclohexene?
4-isocyano-1,2-dimethylcyclohexene has a molecular weight of 135.21 g/mol, XLogP of 2.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyano-1,2-dimethylcyclohexene is sourced from PubChem (CID 123764505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).