About 3-azido-1,2-dimethylcyclohexene
3-azido-1,2-dimethylcyclohexene (PubChem CID 90775284) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-azido-1,2-dimethylcyclohexene.
Molecular Properties
| Compound Name | 3-azido-1,2-dimethylcyclohexene |
| PubChem CID | 90775284 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 3-azido-1,2-dimethylcyclohexene |
| SMILES | CC1=C(C)C(N=[N+]=[N-])CCC1 |
| InChI | InChI=1S/C8H13N3/c1-6-4-3-5-8(7(6)2)10-11-9/h8H,3-5H2,1-2H3 |
| InChIKey | QDOHFQVIWSWNNP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-1,2-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-1,2-dimethylcyclohexene?
The IUPAC name of 3-azido-1,2-dimethylcyclohexene (CID 90775284) is 3-azido-1,2-dimethylcyclohexene.
What is the SMILES notation for 3-azido-1,2-dimethylcyclohexene?
The canonical SMILES for 3-azido-1,2-dimethylcyclohexene is CC1=C(C)C(N=[N+]=[N-])CCC1.
What is the InChIKey of 3-azido-1,2-dimethylcyclohexene?
The InChIKey is QDOHFQVIWSWNNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6-4-3-5-8(7(6)2)10-11-9/h8H,3-5H2,1-2H3.
What are the key properties of 3-azido-1,2-dimethylcyclohexene?
3-azido-1,2-dimethylcyclohexene has a molecular weight of 151.21 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-1,2-dimethylcyclohexene is sourced from PubChem (CID 90775284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).