C14H17N3 — CID 123765816
6-pentan-3-yl-2,6,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaene (PubChem CID 123765816) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 6-pentan-3-yl-2,6,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaene.
| Compound Name | 6-pentan-3-yl-2,6,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaene |
|---|---|
| PubChem CID | 123765816 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 6-pentan-3-yl-2,6,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaene |
| SMILES | CCC(CC)N1C=c2ccnc3c2=C(C=N3)C1 |
| InChI | InChI=1S/C14H17N3/c1-3-12(4-2)17-8-10-5-6-15-14-13(10)11(9-17)7-16-14/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | BECASHFFFKEBCG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |