C13H18N2 — CID 90790268
1-cyclobutyl-6-ethyl-5,6-dihydropyrrolo[2,3-b]pyridine (PubChem CID 90790268) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-cyclobutyl-6-ethyl-5,6-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | 1-cyclobutyl-6-ethyl-5,6-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 90790268 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-cyclobutyl-6-ethyl-5,6-dihydropyrrolo[2,3-b]pyridine |
| SMILES | CCC1CC=c2ccn(C3CCC3)c2=N1 |
| InChI | InChI=1S/C13H18N2/c1-2-11-7-6-10-8-9-15(13(10)14-11)12-4-3-5-12/h6,8-9,11-12H,2-5,7H2,1H3 |
| InChIKey | ACZXADBGNPMTRR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |