C15H20N2 — CID 90856754
1-cyclobutyl-6-ethyl-7-methyl-5H-pyrrolo[2,3-b]azepine (PubChem CID 90856754) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-cyclobutyl-6-ethyl-7-methyl-5H-pyrrolo[2,3-b]azepine.
| Compound Name | 1-cyclobutyl-6-ethyl-7-methyl-5H-pyrrolo[2,3-b]azepine |
|---|---|
| PubChem CID | 90856754 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-cyclobutyl-6-ethyl-7-methyl-5H-pyrrolo[2,3-b]azepine |
| SMILES | CCC1=C(C)N=c2c(ccn2C2CCC2)=CC1 |
| InChI | InChI=1S/C15H20N2/c1-3-12-7-8-13-9-10-17(14-5-4-6-14)15(13)16-11(12)2/h8-10,14H,3-7H2,1-2H3 |
| InChIKey | TUFBBJLEVBYECE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |