C10H18N+ — CID 123767520
4,5-dimethylhexa-3,5-dienylidene(dimethyl)azanium (PubChem CID 123767520) has the molecular formula C10H18N+ and a molecular weight of 152.26 g/mol. Its IUPAC name is 4,5-dimethylhexa-3,5-dienylidene(dimethyl)azanium.
| Compound Name | 4,5-dimethylhexa-3,5-dienylidene(dimethyl)azanium |
|---|---|
| PubChem CID | 123767520 |
| Molecular Formula | C10H18N+ |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.14 |
| IUPAC Name | 4,5-dimethylhexa-3,5-dienylidene(dimethyl)azanium |
| SMILES | C=C(C)C(C)=CCC=[N+](C)C |
| InChI | InChI=1S/C10H18N/c1-9(2)10(3)7-6-8-11(4)5/h7-8H,1,6H2,2-5H3/q+1 |
| InChIKey | ULMJWYLIZIDVSK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|