C16H27NO — CID 123767669
6-cyclopentyl-N,N,5-trimethylcycloheptene-1-carboxamide (PubChem CID 123767669) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 6-cyclopentyl-N,N,5-trimethylcycloheptene-1-carboxamide.
| Compound Name | 6-cyclopentyl-N,N,5-trimethylcycloheptene-1-carboxamide |
|---|---|
| PubChem CID | 123767669 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 6-cyclopentyl-N,N,5-trimethylcycloheptene-1-carboxamide |
| SMILES | CC1CCC=C(C(=O)N(C)C)CC1C1CCCC1 |
| InChI | InChI=1S/C16H27NO/c1-12-7-6-10-14(16(18)17(2)3)11-15(12)13-8-4-5-9-13/h10,12-13,15H,4-9,11H2,1-3H3 |
| InChIKey | CVGOUADIZVMLSE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |