C33H30F2N6O2S — CID 123767683
5-[[2-[benzyl-[4-[[4-(2,6-difluorophenyl)-3-pyridinyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123767683) has the molecular formula C33H30F2N6O2S and a molecular weight of 612.71 g/mol. Its IUPAC name is 5-[[2-[benzyl-[4-[[4-(2,6-difluorophenyl)-3-pyridinyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[benzyl-[4-[[4-(2,6-difluorophenyl)-3-pyridinyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123767683 |
| Molecular Formula | C33H30F2N6O2S |
| Molecular Weight | 612.71 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 5-[[2-[benzyl-[4-[[4-(2,6-difluorophenyl)-3-pyridinyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N(Cc3ccccc3)C3CCC(NCc4cnccc4-c4c(F)cccc4F)CC3)n2)S1 |
| InChI | InChI=1S/C33H30F2N6O2S/c34-27-7-4-8-28(35)30(27)26-14-15-36-18-22(26)19-38-23-9-11-25(12-10-23)41(20-21-5-2-1-3-6-21)32-37-16-13-24(39-32)17-29-31(42)40-33(43)44-29/h1-8,13-18,23,25,38H,9-12,19-20H2,(H,40,42,43) |
| InChIKey | UHBWRYYHIMEEGV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|