C17H19NO6 — CID 123767686
(2,5-dihydroxypyrrol-1-yl) 4-[(2,5-dioxocyclopent-3-en-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 123767686) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[(2,5-dioxocyclopent-3-en-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[(2,5-dioxocyclopent-3-en-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123767686 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[(2,5-dioxocyclopent-3-en-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | O=C(On1c(O)ccc1O)C1CCC(CC2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C17H19NO6/c19-13-5-6-14(20)12(13)9-10-1-3-11(4-2-10)17(23)24-18-15(21)7-8-16(18)22/h5-8,10-12,21-22H,1-4,9H2 |
| InChIKey | NJYQHEIDFJLVKW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|