C25H38N2O3 — CID 123770719
[1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] 2-(dimethylamino)acetate (PubChem CID 123770719) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is [1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] 2-(dimethylamino)acetate.
| Compound Name | [1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 123770719 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | [1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] 2-(dimethylamino)acetate |
| SMILES | CC(=NOC(=O)CN(C)C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H38N2O3/c1-16(26-30-23(29)15-27(4)5)20-8-9-21-19-7-6-17-14-18(28)10-12-24(17,2)22(19)11-13-25(20,21)3/h14,19-22H,6-13,15H2,1-5H3/t19-,20+,21-,22-,24-,25+/m0/s1 |
| InChIKey | SEWTVFYJEOOPFB-GAAPGKSGSA-N |
| XLogP | 4.62 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|