C29H45N2O3+ — CID 70697107
[(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] 1,1-dimethylpiperidin-1-ium-4-carboxylate (PubChem CID 70697107) has the molecular formula C29H45N2O3+ and a molecular weight of 469.69 g/mol. Its IUPAC name is [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] 1,1-dimethylpiperidin-1-ium-4-carboxylate.
| Compound Name | [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] 1,1-dimethylpiperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 70697107 |
| Molecular Formula | C29H45N2O3+ |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 469.34 |
| IUPAC Name | [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] 1,1-dimethylpiperidin-1-ium-4-carboxylate |
| SMILES | C/C(=N\OC(=O)C1CC[N+](C)(C)CC1)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H45N2O3/c1-19(30-34-27(33)20-12-16-31(4,5)17-13-20)24-8-9-25-23-7-6-21-18-22(32)10-14-28(21,2)26(23)11-15-29(24,25)3/h18,20,23-26H,6-17H2,1-5H3/q+1/b30-19+/t23-,24+,25-,26-,28-,29+/m0/s1 |
| InChIKey | FYEMBTCTEMCQBB-WAZLZMGPSA-N |
| XLogP | 5.54 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|