C13H14O5 — CID 123770863
6-(1-methoxypropan-2-yloxy)-1-benzofuran-3-carboxylic acid (PubChem CID 123770863) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 6-(1-methoxypropan-2-yloxy)-1-benzofuran-3-carboxylic acid.
| Compound Name | 6-(1-methoxypropan-2-yloxy)-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 123770863 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 6-(1-methoxypropan-2-yloxy)-1-benzofuran-3-carboxylic acid |
| SMILES | COCC(C)Oc1ccc2c(C(=O)O)coc2c1 |
| InChI | InChI=1S/C13H14O5/c1-8(6-16-2)18-9-3-4-10-11(13(14)15)7-17-12(10)5-9/h3-5,7-8H,6H2,1-2H3,(H,14,15) |
| InChIKey | SVWBKTISOPBAJM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |