C18H25BN4O5 — CID 123771530
[4-[6-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]pyrazin-2-yl]oxyphenyl]boronic acid (PubChem CID 123771530) has the molecular formula C18H25BN4O5 and a molecular weight of 388.23 g/mol. Its IUPAC name is [4-[6-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]pyrazin-2-yl]oxyphenyl]boronic acid.
| Compound Name | [4-[6-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]pyrazin-2-yl]oxyphenyl]boronic acid |
|---|---|
| PubChem CID | 123771530 |
| Molecular Formula | C18H25BN4O5 |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [4-[6-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]pyrazin-2-yl]oxyphenyl]boronic acid |
| SMILES | CN(CCNc1cncc(Oc2ccc(B(O)O)cc2)n1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25BN4O5/c1-18(2,3)28-17(24)23(4)10-9-21-15-11-20-12-16(22-15)27-14-7-5-13(6-8-14)19(25)26/h5-8,11-12,25-26H,9-10H2,1-4H3,(H,21,22) |
| InChIKey | DFCFCBFEJYJFJT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|