C12H21BN4O4 — CID 155897484
[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]pyrimidin-5-yl]boronic acid (PubChem CID 155897484) has the molecular formula C12H21BN4O4 and a molecular weight of 296.14 g/mol. Its IUPAC name is [2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]pyrimidin-5-yl]boronic acid.
| Compound Name | [2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]pyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 155897484 |
| Molecular Formula | C12H21BN4O4 |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | [2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]pyrimidin-5-yl]boronic acid |
| SMILES | CN(CCNc1ncc(B(O)O)cn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21BN4O4/c1-12(2,3)21-11(18)17(4)6-5-14-10-15-7-9(8-16-10)13(19)20/h7-8,19-20H,5-6H2,1-4H3,(H,14,15,16) |
| InChIKey | BQLQZUASIWSDMM-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|