C14H22BN3O6 — CID 66545386
[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]boronic acid (PubChem CID 66545386) has the molecular formula C14H22BN3O6 and a molecular weight of 339.16 g/mol. Its IUPAC name is [2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]boronic acid.
| Compound Name | [2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 66545386 |
| Molecular Formula | C14H22BN3O6 |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ncc(B(O)O)cn1 |
| InChI | InChI=1S/C14H22BN3O6/c1-13(2,3)23-11(19)18(12(20)24-14(4,5)6)10-16-7-9(8-17-10)15(21)22/h7-8,21-22H,1-6H3 |
| InChIKey | YFKDVHNYIKJGIX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|