C15H20ClN3O5 — CID 123547852
tert-butyl N-(5-chloro-4-formylpyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 123547852) has the molecular formula C15H20ClN3O5 and a molecular weight of 357.79 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-4-formylpyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-(5-chloro-4-formylpyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 123547852 |
| Molecular Formula | C15H20ClN3O5 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | tert-butyl N-(5-chloro-4-formylpyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ncc(Cl)c(C=O)n1 |
| InChI | InChI=1S/C15H20ClN3O5/c1-14(2,3)23-12(21)19(13(22)24-15(4,5)6)11-17-7-9(16)10(8-20)18-11/h7-8H,1-6H3 |
| InChIKey | KCUFPXUSFLVOOE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|